C29H27FN2O — CID 3428555
N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-2,2-diphenyl-N-prop-2-enylacetamide (PubChem CID 3428555) has the molecular formula C29H27FN2O and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-2,2-diphenyl-N-prop-2-enylacetamide.
| Compound Name | N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-2,2-diphenyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 3428555 |
| Molecular Formula | C29H27FN2O |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-2,2-diphenyl-N-prop-2-enylacetamide |
| SMILES | C=CCN(Cc1cccn1Cc1cccc(F)c1)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H27FN2O/c1-2-18-32(22-27-17-10-19-31(27)21-23-11-9-16-26(30)20-23)29(33)28(24-12-5-3-6-13-24)25-14-7-4-8-15-25/h2-17,19-20,28H,1,18,21-22H2 |
| InChIKey | OIELAKSCSXVCST-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|