C22H22ClFN2O — CID 3322916
N-benzyl-2-chloro-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]propanamide (PubChem CID 3322916) has the molecular formula C22H22ClFN2O and a molecular weight of 384.88 g/mol. Its IUPAC name is N-benzyl-2-chloro-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]propanamide.
| Compound Name | N-benzyl-2-chloro-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 3322916 |
| Molecular Formula | C22H22ClFN2O |
| Molecular Weight | 384.88 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-benzyl-2-chloro-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]propanamide |
| SMILES | CC(Cl)C(=O)N(Cc1ccccc1)Cc1cccn1Cc1cccc(F)c1 |
| InChI | InChI=1S/C22H22ClFN2O/c1-17(23)22(27)26(14-18-7-3-2-4-8-18)16-21-11-6-12-25(21)15-19-9-5-10-20(24)13-19/h2-13,17H,14-16H2,1H3 |
| InChIKey | SMMWWJIHVABEFK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.88 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|