C23H24ClFN2O — CID 3267120
2-chloro-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methylpropyl)benzamide (PubChem CID 3267120) has the molecular formula C23H24ClFN2O and a molecular weight of 398.91 g/mol. Its IUPAC name is 2-chloro-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methylpropyl)benzamide.
| Compound Name | 2-chloro-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 3267120 |
| Molecular Formula | C23H24ClFN2O |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-chloro-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(Cc1cccn1Cc1cccc(F)c1)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C23H24ClFN2O/c1-17(2)14-27(23(28)21-10-3-4-11-22(21)24)16-20-9-6-12-26(20)15-18-7-5-8-19(25)13-18/h3-13,17H,14-16H2,1-2H3 |
| InChIKey | GEVAOTRUIPHPAZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |