C22H23ClN2O — CID 5004292
N-[(1-benzylpyrrol-2-yl)methyl]-2-chloro-N-propan-2-ylbenzamide (PubChem CID 5004292) has the molecular formula C22H23ClN2O and a molecular weight of 366.89 g/mol. Its IUPAC name is N-[(1-benzylpyrrol-2-yl)methyl]-2-chloro-N-propan-2-ylbenzamide.
| Compound Name | N-[(1-benzylpyrrol-2-yl)methyl]-2-chloro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 5004292 |
| Molecular Formula | C22H23ClN2O |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-[(1-benzylpyrrol-2-yl)methyl]-2-chloro-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(Cc1cccn1Cc1ccccc1)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C22H23ClN2O/c1-17(2)25(22(26)20-12-6-7-13-21(20)23)16-19-11-8-14-24(19)15-18-9-4-3-5-10-18/h3-14,17H,15-16H2,1-2H3 |
| InChIKey | BBFLXKNDYSQXRP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |