C25H31N3O — CID 3915867
1-[(1-benzylpyrrol-2-yl)methyl]-1-propan-2-yl-3-(4-propan-2-ylphenyl)urea (PubChem CID 3915867) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is 1-[(1-benzylpyrrol-2-yl)methyl]-1-propan-2-yl-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-[(1-benzylpyrrol-2-yl)methyl]-1-propan-2-yl-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 3915867 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 1-[(1-benzylpyrrol-2-yl)methyl]-1-propan-2-yl-3-(4-propan-2-ylphenyl)urea |
| SMILES | CC(C)c1ccc(NC(=O)N(Cc2cccn2Cc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C25H31N3O/c1-19(2)22-12-14-23(15-13-22)26-25(29)28(20(3)4)18-24-11-8-16-27(24)17-21-9-6-5-7-10-21/h5-16,19-20H,17-18H2,1-4H3,(H,26,29) |
| InChIKey | JBYLRUBHKRKYCB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |