C22H24BrN3O — CID 3910490
1-[(1-benzylpyrrol-2-yl)methyl]-3-(2-bromophenyl)-1-propan-2-ylurea (PubChem CID 3910490) has the molecular formula C22H24BrN3O and a molecular weight of 426.36 g/mol. Its IUPAC name is 1-[(1-benzylpyrrol-2-yl)methyl]-3-(2-bromophenyl)-1-propan-2-ylurea.
| Compound Name | 1-[(1-benzylpyrrol-2-yl)methyl]-3-(2-bromophenyl)-1-propan-2-ylurea |
|---|---|
| PubChem CID | 3910490 |
| Molecular Formula | C22H24BrN3O |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 1-[(1-benzylpyrrol-2-yl)methyl]-3-(2-bromophenyl)-1-propan-2-ylurea |
| SMILES | CC(C)N(Cc1cccn1Cc1ccccc1)C(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C22H24BrN3O/c1-17(2)26(22(27)24-21-13-7-6-12-20(21)23)16-19-11-8-14-25(19)15-18-9-4-3-5-10-18/h3-14,17H,15-16H2,1-2H3,(H,24,27) |
| InChIKey | MGQOIUWASHDNQJ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |