C25H27BrFN3O — CID 42663076
3-(2-bromophenyl)-1-cyclohexyl-1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]urea (PubChem CID 42663076) has the molecular formula C25H27BrFN3O and a molecular weight of 484.41 g/mol. Its IUPAC name is 3-(2-bromophenyl)-1-cyclohexyl-1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]urea.
| Compound Name | 3-(2-bromophenyl)-1-cyclohexyl-1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]urea |
|---|---|
| PubChem CID | 42663076 |
| Molecular Formula | C25H27BrFN3O |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 3-(2-bromophenyl)-1-cyclohexyl-1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]urea |
| SMILES | O=C(Nc1ccccc1Br)N(Cc1cccn1Cc1ccc(F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C25H27BrFN3O/c26-23-10-4-5-11-24(23)28-25(31)30(21-7-2-1-3-8-21)18-22-9-6-16-29(22)17-19-12-14-20(27)15-13-19/h4-6,9-16,21H,1-3,7-8,17-18H2,(H,28,31) |
| InChIKey | PEIRGVVTVIJVHE-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |