C24H31BrN2O — CID 3954494
N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylcyclopentanecarboxamide (PubChem CID 3954494) has the molecular formula C24H31BrN2O and a molecular weight of 443.43 g/mol. Its IUPAC name is N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylcyclopentanecarboxamide.
| Compound Name | N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylcyclopentanecarboxamide |
|---|---|
| PubChem CID | 3954494 |
| Molecular Formula | C24H31BrN2O |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylcyclopentanecarboxamide |
| SMILES | O=C(C1CCCC1)N(Cc1cccn1Cc1ccc(Br)cc1)C1CCCCC1 |
| InChI | InChI=1S/C24H31BrN2O/c25-21-14-12-19(13-15-21)17-26-16-6-11-23(26)18-27(22-9-2-1-3-10-22)24(28)20-7-4-5-8-20/h6,11-16,20,22H,1-5,7-10,17-18H2 |
| InChIKey | APNLAOMWGREWFL-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |