C22H27BrN2O — CID 3665186
N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylcyclopropanecarboxamide (PubChem CID 3665186) has the molecular formula C22H27BrN2O and a molecular weight of 415.38 g/mol. Its IUPAC name is N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylcyclopropanecarboxamide.
| Compound Name | N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylcyclopropanecarboxamide |
|---|---|
| PubChem CID | 3665186 |
| Molecular Formula | C22H27BrN2O |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylcyclopropanecarboxamide |
| SMILES | O=C(C1CC1)N(Cc1cccn1Cc1ccc(Br)cc1)C1CCCCC1 |
| InChI | InChI=1S/C22H27BrN2O/c23-19-12-8-17(9-13-19)15-24-14-4-7-21(24)16-25(22(26)18-10-11-18)20-5-2-1-3-6-20/h4,7-9,12-14,18,20H,1-3,5-6,10-11,15-16H2 |
| InChIKey | KREUUAJFOBZJCZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |