C25H26F2N2O — CID 42762619
N-cyclohexyl-4-fluoro-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]benzamide (PubChem CID 42762619) has the molecular formula C25H26F2N2O and a molecular weight of 408.49 g/mol. Its IUPAC name is N-cyclohexyl-4-fluoro-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]benzamide.
| Compound Name | N-cyclohexyl-4-fluoro-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 42762619 |
| Molecular Formula | C25H26F2N2O |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-cyclohexyl-4-fluoro-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]benzamide |
| SMILES | O=C(c1ccc(F)cc1)N(Cc1cccn1Cc1ccc(F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C25H26F2N2O/c26-21-12-8-19(9-13-21)17-28-16-4-7-24(28)18-29(23-5-2-1-3-6-23)25(30)20-10-14-22(27)15-11-20/h4,7-16,23H,1-3,5-6,17-18H2 |
| InChIKey | DKUPHPCNIRUNMA-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |