C28H34N2O — CID 4552886
N-cyclohexyl-4-ethyl-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]benzamide (PubChem CID 4552886) has the molecular formula C28H34N2O and a molecular weight of 414.59 g/mol. Its IUPAC name is N-cyclohexyl-4-ethyl-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]benzamide.
| Compound Name | N-cyclohexyl-4-ethyl-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 4552886 |
| Molecular Formula | C28H34N2O |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | N-cyclohexyl-4-ethyl-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]benzamide |
| SMILES | CCc1ccc(C(=O)N(Cc2cccn2Cc2cccc(C)c2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C28H34N2O/c1-3-23-14-16-25(17-15-23)28(31)30(26-11-5-4-6-12-26)21-27-13-8-18-29(27)20-24-10-7-9-22(2)19-24/h7-10,13-19,26H,3-6,11-12,20-21H2,1-2H3 |
| InChIKey | BDCJHJWEWBWRMF-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |