C26H30BrN3O — CID 42663078
3-(2-bromophenyl)-1-cyclohexyl-1-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]urea (PubChem CID 42663078) has the molecular formula C26H30BrN3O and a molecular weight of 480.45 g/mol. Its IUPAC name is 3-(2-bromophenyl)-1-cyclohexyl-1-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]urea.
| Compound Name | 3-(2-bromophenyl)-1-cyclohexyl-1-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]urea |
|---|---|
| PubChem CID | 42663078 |
| Molecular Formula | C26H30BrN3O |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 3-(2-bromophenyl)-1-cyclohexyl-1-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]urea |
| SMILES | Cc1cccc(Cn2cccc2CN(C(=O)Nc2ccccc2Br)C2CCCCC2)c1 |
| InChI | InChI=1S/C26H30BrN3O/c1-20-9-7-10-21(17-20)18-29-16-8-13-23(29)19-30(22-11-3-2-4-12-22)26(31)28-25-15-6-5-14-24(25)27/h5-10,13-17,22H,2-4,11-12,18-19H2,1H3,(H,28,31) |
| InChIKey | ULSYWCPSGLPZBO-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |