C23H24BrN3O — CID 4243859
3-(2-bromophenyl)-1-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea (PubChem CID 4243859) has the molecular formula C23H24BrN3O and a molecular weight of 438.37 g/mol. Its IUPAC name is 3-(2-bromophenyl)-1-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea.
| Compound Name | 3-(2-bromophenyl)-1-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 4243859 |
| Molecular Formula | C23H24BrN3O |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 3-(2-bromophenyl)-1-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea |
| SMILES | C=CCN(Cc1cccn1Cc1cccc(C)c1)C(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C23H24BrN3O/c1-3-13-27(23(28)25-22-12-5-4-11-21(22)24)17-20-10-7-14-26(20)16-19-9-6-8-18(2)15-19/h3-12,14-15H,1,13,16-17H2,2H3,(H,25,28) |
| InChIKey | ANKGLQHASYJFSW-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|