C23H24BrN3O2 — CID 42663183
3-(4-bromophenyl)-1-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea (PubChem CID 42663183) has the molecular formula C23H24BrN3O2 and a molecular weight of 454.37 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea.
| Compound Name | 3-(4-bromophenyl)-1-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 42663183 |
| Molecular Formula | C23H24BrN3O2 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 3-(4-bromophenyl)-1-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea |
| SMILES | C=CCN(Cc1cccn1Cc1cccc(OC)c1)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C23H24BrN3O2/c1-3-13-27(23(28)25-20-11-9-19(24)10-12-20)17-21-7-5-14-26(21)16-18-6-4-8-22(15-18)29-2/h3-12,14-15H,1,13,16-17H2,2H3,(H,25,28) |
| InChIKey | XBRKKERJTFOPMF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|