C21H26N2O2 — CID 810263
N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylcyclobutanecarboxamide (PubChem CID 810263) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylcyclobutanecarboxamide.
| Compound Name | N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylcyclobutanecarboxamide |
|---|---|
| PubChem CID | 810263 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylcyclobutanecarboxamide |
| SMILES | C=CCN(Cc1cccn1Cc1cccc(OC)c1)C(=O)C1CCC1 |
| InChI | InChI=1S/C21H26N2O2/c1-3-12-23(21(24)18-8-5-9-18)16-19-10-6-13-22(19)15-17-7-4-11-20(14-17)25-2/h3-4,6-7,10-11,13-14,18H,1,5,8-9,12,15-16H2,2H3 |
| InChIKey | QYTYFRMZKSPVLO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|