C26H29ClN2O2 — CID 42762993
2-chloro-N-cyclohexyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]benzamide (PubChem CID 42762993) has the molecular formula C26H29ClN2O2 and a molecular weight of 436.98 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 42762993 |
| Molecular Formula | C26H29ClN2O2 |
| Molecular Weight | 436.98 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 2-chloro-N-cyclohexyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]benzamide |
| SMILES | COc1cccc(Cn2cccc2CN(C(=O)c2ccccc2Cl)C2CCCCC2)c1 |
| InChI | InChI=1S/C26H29ClN2O2/c1-31-23-13-7-9-20(17-23)18-28-16-8-12-22(28)19-29(21-10-3-2-4-11-21)26(30)24-14-5-6-15-25(24)27/h5-9,12-17,21H,2-4,10-11,18-19H2,1H3 |
| InChIKey | NAIILSPOZXBDRJ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.98 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |