C25H30N2O2S — CID 42762998
N-cyclohexyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-2-thiophen-2-ylacetamide (PubChem CID 42762998) has the molecular formula C25H30N2O2S and a molecular weight of 422.59 g/mol. Its IUPAC name is N-cyclohexyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-cyclohexyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 42762998 |
| Molecular Formula | C25H30N2O2S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-cyclohexyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-2-thiophen-2-ylacetamide |
| SMILES | COc1cccc(Cn2cccc2CN(C(=O)Cc2cccs2)C2CCCCC2)c1 |
| InChI | InChI=1S/C25H30N2O2S/c1-29-23-12-5-8-20(16-23)18-26-14-6-11-22(26)19-27(21-9-3-2-4-10-21)25(28)17-24-13-7-15-30-24/h5-8,11-16,21H,2-4,9-10,17-19H2,1H3 |
| InChIKey | REYDPVUIFRCJAZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |