C23H25ClN2OS — CID 42762783
N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylthiophene-2-carboxamide (PubChem CID 42762783) has the molecular formula C23H25ClN2OS and a molecular weight of 412.99 g/mol. Its IUPAC name is N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylthiophene-2-carboxamide.
| Compound Name | N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 42762783 |
| Molecular Formula | C23H25ClN2OS |
| Molecular Weight | 412.99 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylthiophene-2-carboxamide |
| SMILES | O=C(c1cccs1)N(Cc1cccn1Cc1cccc(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C23H25ClN2OS/c24-19-8-4-7-18(15-19)16-25-13-5-11-21(25)17-26(20-9-2-1-3-10-20)23(27)22-12-6-14-28-22/h4-8,11-15,20H,1-3,9-10,16-17H2 |
| InChIKey | MCRFHYKQTIIGSD-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.99 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |