C20H23Cl3N2O — CID 3965068
2,2-dichloro-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylacetamide (PubChem CID 3965068) has the molecular formula C20H23Cl3N2O and a molecular weight of 413.78 g/mol. Its IUPAC name is 2,2-dichloro-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylacetamide.
| Compound Name | 2,2-dichloro-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 3965068 |
| Molecular Formula | C20H23Cl3N2O |
| Molecular Weight | 413.78 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 2,2-dichloro-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylacetamide |
| SMILES | O=C(C(Cl)Cl)N(Cc1cccn1Cc1cccc(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C20H23Cl3N2O/c21-16-7-4-6-15(12-16)13-24-11-5-10-18(24)14-25(20(26)19(22)23)17-8-2-1-3-9-17/h4-7,10-12,17,19H,1-3,8-9,13-14H2 |
| InChIKey | HMQOIGHUWBCJRZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.78 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|