C23H32ClN3O — CID 3429488
1-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-cyclohexyl-1-(2-methylpropyl)urea (PubChem CID 3429488) has the molecular formula C23H32ClN3O and a molecular weight of 401.98 g/mol. Its IUPAC name is 1-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-cyclohexyl-1-(2-methylpropyl)urea.
| Compound Name | 1-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-cyclohexyl-1-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 3429488 |
| Molecular Formula | C23H32ClN3O |
| Molecular Weight | 401.98 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 1-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-cyclohexyl-1-(2-methylpropyl)urea |
| SMILES | CC(C)CN(Cc1cccn1Cc1cccc(Cl)c1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C23H32ClN3O/c1-18(2)15-27(23(28)25-21-10-4-3-5-11-21)17-22-12-7-13-26(22)16-19-8-6-9-20(24)14-19/h6-9,12-14,18,21H,3-5,10-11,15-17H2,1-2H3,(H,25,28) |
| InChIKey | LTCHCEKXAOKFRU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.98 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |