C20H27ClN2O — CID 42763794
N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methylpropyl)butanamide (PubChem CID 42763794) has the molecular formula C20H27ClN2O and a molecular weight of 346.90 g/mol. Its IUPAC name is N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methylpropyl)butanamide.
| Compound Name | N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 42763794 |
| Molecular Formula | C20H27ClN2O |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-(2-methylpropyl)butanamide |
| SMILES | CCCC(=O)N(Cc1cccn1Cc1cccc(Cl)c1)CC(C)C |
| InChI | InChI=1S/C20H27ClN2O/c1-4-7-20(24)23(13-16(2)3)15-19-10-6-11-22(19)14-17-8-5-9-18(21)12-17/h5-6,8-12,16H,4,7,13-15H2,1-3H3 |
| InChIKey | GASKWJZATOZQTK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |