C21H29ClN2O — CID 42764473
N-butan-2-yl-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]pentanamide (PubChem CID 42764473) has the molecular formula C21H29ClN2O and a molecular weight of 360.93 g/mol. Its IUPAC name is N-butan-2-yl-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]pentanamide.
| Compound Name | N-butan-2-yl-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]pentanamide |
|---|---|
| PubChem CID | 42764473 |
| Molecular Formula | C21H29ClN2O |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-butan-2-yl-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]pentanamide |
| SMILES | CCCCC(=O)N(Cc1cccn1Cc1cccc(Cl)c1)C(C)CC |
| InChI | InChI=1S/C21H29ClN2O/c1-4-6-12-21(25)24(17(3)5-2)16-20-11-8-13-23(20)15-18-9-7-10-19(22)14-18/h7-11,13-14,17H,4-6,12,15-16H2,1-3H3 |
| InChIKey | PWWGAUZNVSJXBL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |