C27H42N2O — CID 3914084
N-(3-methylbutan-2-yl)-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]nonanamide (PubChem CID 3914084) has the molecular formula C27H42N2O and a molecular weight of 410.65 g/mol. Its IUPAC name is N-(3-methylbutan-2-yl)-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]nonanamide.
| Compound Name | N-(3-methylbutan-2-yl)-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]nonanamide |
|---|---|
| PubChem CID | 3914084 |
| Molecular Formula | C27H42N2O |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.33 |
| IUPAC Name | N-(3-methylbutan-2-yl)-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]nonanamide |
| SMILES | CCCCCCCCC(=O)N(Cc1cccn1Cc1cccc(C)c1)C(C)C(C)C |
| InChI | InChI=1S/C27H42N2O/c1-6-7-8-9-10-11-17-27(30)29(24(5)22(2)3)21-26-16-13-18-28(26)20-25-15-12-14-23(4)19-25/h12-16,18-19,22,24H,6-11,17,20-21H2,1-5H3 |
| InChIKey | GYAIIZGNSPSUDK-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|