C25H30N2O — CID 4567945
N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-3-phenyl-N-propan-2-ylpropanamide (PubChem CID 4567945) has the molecular formula C25H30N2O and a molecular weight of 374.53 g/mol. Its IUPAC name is N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-3-phenyl-N-propan-2-ylpropanamide.
| Compound Name | N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-3-phenyl-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 4567945 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-3-phenyl-N-propan-2-ylpropanamide |
| SMILES | Cc1cccc(Cn2cccc2CN(C(=O)CCc2ccccc2)C(C)C)c1 |
| InChI | InChI=1S/C25H30N2O/c1-20(2)27(25(28)15-14-22-10-5-4-6-11-22)19-24-13-8-16-26(24)18-23-12-7-9-21(3)17-23/h4-13,16-17,20H,14-15,18-19H2,1-3H3 |
| InChIKey | AQYLORPYPVQZBD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |