C21H29N3O3 — CID 3297268
ethyl 2-[[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl-propan-2-ylcarbamoyl]amino]acetate (PubChem CID 3297268) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is ethyl 2-[[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl-propan-2-ylcarbamoyl]amino]acetate.
| Compound Name | ethyl 2-[[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl-propan-2-ylcarbamoyl]amino]acetate |
|---|---|
| PubChem CID | 3297268 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | ethyl 2-[[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl-propan-2-ylcarbamoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N(Cc1cccn1Cc1cccc(C)c1)C(C)C |
| InChI | InChI=1S/C21H29N3O3/c1-5-27-20(25)13-22-21(26)24(16(2)3)15-19-10-7-11-23(19)14-18-9-6-8-17(4)12-18/h6-12,16H,5,13-15H2,1-4H3,(H,22,26) |
| InChIKey | UNFGQWUJAAXVDJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |