C27H34N2O — CID 3453162
4-tert-butyl-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-propan-2-ylbenzamide (PubChem CID 3453162) has the molecular formula C27H34N2O and a molecular weight of 402.58 g/mol. Its IUPAC name is 4-tert-butyl-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-propan-2-ylbenzamide.
| Compound Name | 4-tert-butyl-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 3453162 |
| Molecular Formula | C27H34N2O |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 4-tert-butyl-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-propan-2-ylbenzamide |
| SMILES | Cc1cccc(Cn2cccc2CN(C(=O)c2ccc(C(C)(C)C)cc2)C(C)C)c1 |
| InChI | InChI=1S/C27H34N2O/c1-20(2)29(26(30)23-12-14-24(15-13-23)27(4,5)6)19-25-11-8-16-28(25)18-22-10-7-9-21(3)17-22/h7-17,20H,18-19H2,1-6H3 |
| InChIKey | NAVLOLLDGRYREC-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |