C24H27ClN2O — CID 7397709
N-[(2S)-butan-2-yl]-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-4-methylbenzamide (PubChem CID 7397709) has the molecular formula C24H27ClN2O and a molecular weight of 394.95 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-4-methylbenzamide.
| Compound Name | N-[(2S)-butan-2-yl]-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 7397709 |
| Molecular Formula | C24H27ClN2O |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N-[(2S)-butan-2-yl]-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-4-methylbenzamide |
| SMILES | CC[C@H](C)N(Cc1cccn1Cc1cccc(Cl)c1)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H27ClN2O/c1-4-19(3)27(24(28)21-12-10-18(2)11-13-21)17-23-9-6-14-26(23)16-20-7-5-8-22(25)15-20/h5-15,19H,4,16-17H2,1-3H3/t19-/m0/s1 |
| InChIKey | HAAZPBCXXYJOQO-IBGZPJMESA-N |
| XLogP | 5.94 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |