C23H24Cl2N2O — CID 7259451
N-[(2R)-butan-2-yl]-3-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]benzamide (PubChem CID 7259451) has the molecular formula C23H24Cl2N2O and a molecular weight of 415.36 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-3-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]benzamide.
| Compound Name | N-[(2R)-butan-2-yl]-3-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 7259451 |
| Molecular Formula | C23H24Cl2N2O |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | N-[(2R)-butan-2-yl]-3-chloro-N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]benzamide |
| SMILES | CC[C@@H](C)N(Cc1cccn1Cc1ccccc1Cl)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H24Cl2N2O/c1-3-17(2)27(23(28)18-9-6-10-20(24)14-18)16-21-11-7-13-26(21)15-19-8-4-5-12-22(19)25/h4-14,17H,3,15-16H2,1-2H3/t17-/m1/s1 |
| InChIKey | JIEBMYGZNFLUEK-QGZVFWFLSA-N |
| XLogP | 6.28 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |