C23H25ClN2O — CID 3322535
N-butan-2-yl-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]benzamide (PubChem CID 3322535) has the molecular formula C23H25ClN2O and a molecular weight of 380.92 g/mol. Its IUPAC name is N-butan-2-yl-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]benzamide.
| Compound Name | N-butan-2-yl-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 3322535 |
| Molecular Formula | C23H25ClN2O |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-butan-2-yl-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]benzamide |
| SMILES | CCC(C)N(Cc1cccn1Cc1cccc(Cl)c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H25ClN2O/c1-3-18(2)26(23(27)20-10-5-4-6-11-20)17-22-13-8-14-25(22)16-19-9-7-12-21(24)15-19/h4-15,18H,3,16-17H2,1-2H3 |
| InChIKey | MCDFTMFZYKHUFH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |