C19H24Cl2N2O — CID 3946261
N-butan-2-yl-2-chloro-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]propanamide (PubChem CID 3946261) has the molecular formula C19H24Cl2N2O and a molecular weight of 367.32 g/mol. Its IUPAC name is N-butan-2-yl-2-chloro-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]propanamide.
| Compound Name | N-butan-2-yl-2-chloro-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 3946261 |
| Molecular Formula | C19H24Cl2N2O |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | N-butan-2-yl-2-chloro-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]propanamide |
| SMILES | CCC(C)N(Cc1cccn1Cc1cccc(Cl)c1)C(=O)C(C)Cl |
| InChI | InChI=1S/C19H24Cl2N2O/c1-4-14(2)23(19(24)15(3)20)13-18-9-6-10-22(18)12-16-7-5-8-17(21)11-16/h5-11,14-15H,4,12-13H2,1-3H3 |
| InChIKey | LLSAXUKSZIHJGC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|