C26H31ClN2O — CID 5027042
N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentyl-3-phenylpropanamide (PubChem CID 5027042) has the molecular formula C26H31ClN2O and a molecular weight of 423.00 g/mol. Its IUPAC name is N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentyl-3-phenylpropanamide.
| Compound Name | N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 5027042 |
| Molecular Formula | C26H31ClN2O |
| Molecular Weight | 423.00 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentyl-3-phenylpropanamide |
| SMILES | CCCCCN(Cc1cccn1Cc1cccc(Cl)c1)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C26H31ClN2O/c1-2-3-7-17-29(26(30)16-15-22-10-5-4-6-11-22)21-25-14-9-18-28(25)20-23-12-8-13-24(27)19-23/h4-6,8-14,18-19H,2-3,7,15-17,20-21H2,1H3 |
| InChIKey | PXSQCIJQEZYRSL-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.00 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|