C21H30N2O — CID 4542851
N-[(1-benzylpyrrol-2-yl)methyl]-N-propylhexanamide (PubChem CID 4542851) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is N-[(1-benzylpyrrol-2-yl)methyl]-N-propylhexanamide.
| Compound Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-propylhexanamide |
|---|---|
| PubChem CID | 4542851 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-propylhexanamide |
| SMILES | CCCCCC(=O)N(CCC)Cc1cccn1Cc1ccccc1 |
| InChI | InChI=1S/C21H30N2O/c1-3-5-7-14-21(24)23(15-4-2)18-20-13-10-16-22(20)17-19-11-8-6-9-12-19/h6,8-13,16H,3-5,7,14-15,17-18H2,1-2H3 |
| InChIKey | IOOCAGVYALIJLS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|