C27H40BrN3O2 — CID 4530699
N-[2-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl-butylamino]-2-oxoethyl]-N-propylhexanamide (PubChem CID 4530699) has the molecular formula C27H40BrN3O2 and a molecular weight of 518.54 g/mol. Its IUPAC name is N-[2-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl-butylamino]-2-oxoethyl]-N-propylhexanamide.
| Compound Name | N-[2-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl-butylamino]-2-oxoethyl]-N-propylhexanamide |
|---|---|
| PubChem CID | 4530699 |
| Molecular Formula | C27H40BrN3O2 |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | N-[2-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl-butylamino]-2-oxoethyl]-N-propylhexanamide |
| SMILES | CCCCCC(=O)N(CCC)CC(=O)N(CCCC)Cc1cccn1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C27H40BrN3O2/c1-4-7-9-12-26(32)30(17-6-3)22-27(33)31(18-8-5-2)21-25-11-10-19-29(25)20-23-13-15-24(28)16-14-23/h10-11,13-16,19H,4-9,12,17-18,20-22H2,1-3H3 |
| InChIKey | VRBSOPCOHZSALW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|