C26H38BrN3O3 — CID 3953414
N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-butyl-2-[(2-methoxyacetyl)-pentylamino]acetamide (PubChem CID 3953414) has the molecular formula C26H38BrN3O3 and a molecular weight of 520.51 g/mol. Its IUPAC name is N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-butyl-2-[(2-methoxyacetyl)-pentylamino]acetamide.
| Compound Name | N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-butyl-2-[(2-methoxyacetyl)-pentylamino]acetamide |
|---|---|
| PubChem CID | 3953414 |
| Molecular Formula | C26H38BrN3O3 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-butyl-2-[(2-methoxyacetyl)-pentylamino]acetamide |
| SMILES | CCCCCN(CC(=O)N(CCCC)Cc1cccn1Cc1ccc(Br)cc1)C(=O)COC |
| InChI | InChI=1S/C26H38BrN3O3/c1-4-6-8-16-30(26(32)21-33-3)20-25(31)29(15-7-5-2)19-24-10-9-17-28(24)18-22-11-13-23(27)14-12-22/h9-14,17H,4-8,15-16,18-21H2,1-3H3 |
| InChIKey | UQYBJRHCBWQXAG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|