C20H28N2O2 — CID 4574832
N-[(1-benzylpyrrol-2-yl)methyl]-2-methoxy-N-pentylacetamide (PubChem CID 4574832) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N-[(1-benzylpyrrol-2-yl)methyl]-2-methoxy-N-pentylacetamide.
| Compound Name | N-[(1-benzylpyrrol-2-yl)methyl]-2-methoxy-N-pentylacetamide |
|---|---|
| PubChem CID | 4574832 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | N-[(1-benzylpyrrol-2-yl)methyl]-2-methoxy-N-pentylacetamide |
| SMILES | CCCCCN(Cc1cccn1Cc1ccccc1)C(=O)COC |
| InChI | InChI=1S/C20H28N2O2/c1-3-4-8-13-22(20(23)17-24-2)16-19-12-9-14-21(19)15-18-10-6-5-7-11-18/h5-7,9-12,14H,3-4,8,13,15-17H2,1-2H3 |
| InChIKey | SJQNVLDXMDBLGO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|