C26H31ClN2O2 — CID 3977868
N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentyl-2-phenylmethoxyacetamide (PubChem CID 3977868) has the molecular formula C26H31ClN2O2 and a molecular weight of 439.00 g/mol. Its IUPAC name is N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentyl-2-phenylmethoxyacetamide.
| Compound Name | N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentyl-2-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 3977868 |
| Molecular Formula | C26H31ClN2O2 |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentyl-2-phenylmethoxyacetamide |
| SMILES | CCCCCN(Cc1cccn1Cc1cccc(Cl)c1)C(=O)COCc1ccccc1 |
| InChI | InChI=1S/C26H31ClN2O2/c1-2-3-7-15-29(26(30)21-31-20-22-10-5-4-6-11-22)19-25-14-9-16-28(25)18-23-12-8-13-24(27)17-23/h4-6,8-14,16-17H,2-3,7,15,18-21H2,1H3 |
| InChIKey | ZLESRUODHUNQAB-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|