C22H30Cl2N2O — CID 3518133
3-chloro-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-2,2-dimethyl-N-pentylpropanamide (PubChem CID 3518133) has the molecular formula C22H30Cl2N2O and a molecular weight of 409.40 g/mol. Its IUPAC name is 3-chloro-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-2,2-dimethyl-N-pentylpropanamide.
| Compound Name | 3-chloro-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-2,2-dimethyl-N-pentylpropanamide |
|---|---|
| PubChem CID | 3518133 |
| Molecular Formula | C22H30Cl2N2O |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 3-chloro-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-2,2-dimethyl-N-pentylpropanamide |
| SMILES | CCCCCN(Cc1cccn1Cc1cccc(Cl)c1)C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C22H30Cl2N2O/c1-4-5-6-12-26(21(27)22(2,3)17-23)16-20-11-8-13-25(20)15-18-9-7-10-19(24)14-18/h7-11,13-14H,4-6,12,15-17H2,1-3H3 |
| InChIKey | STTCQMWUURKRGF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|