C25H26ClF3N2O — CID 4683403
N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentyl-3-(trifluoromethyl)benzamide (PubChem CID 4683403) has the molecular formula C25H26ClF3N2O and a molecular weight of 462.94 g/mol. Its IUPAC name is N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentyl-3-(trifluoromethyl)benzamide.
| Compound Name | N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 4683403 |
| Molecular Formula | C25H26ClF3N2O |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-pentyl-3-(trifluoromethyl)benzamide |
| SMILES | CCCCCN(Cc1cccn1Cc1cccc(Cl)c1)C(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H26ClF3N2O/c1-2-3-4-13-31(24(32)20-9-6-10-21(16-20)25(27,28)29)18-23-12-7-14-30(23)17-19-8-5-11-22(26)15-19/h5-12,14-16H,2-4,13,17-18H2,1H3 |
| InChIKey | BCVJJBXKXSNSME-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|