C25H29ClN2O — CID 3358975
N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-2-methyl-N-pentylbenzamide (PubChem CID 3358975) has the molecular formula C25H29ClN2O and a molecular weight of 408.97 g/mol. Its IUPAC name is N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-2-methyl-N-pentylbenzamide.
| Compound Name | N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-2-methyl-N-pentylbenzamide |
|---|---|
| PubChem CID | 3358975 |
| Molecular Formula | C25H29ClN2O |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-2-methyl-N-pentylbenzamide |
| SMILES | CCCCCN(Cc1cccn1Cc1cccc(Cl)c1)C(=O)c1ccccc1C |
| InChI | InChI=1S/C25H29ClN2O/c1-3-4-7-15-28(25(29)24-14-6-5-10-20(24)2)19-23-13-9-16-27(23)18-21-11-8-12-22(26)17-21/h5-6,8-14,16-17H,3-4,7,15,18-19H2,1-2H3 |
| InChIKey | CNRRJBYKRLAOIQ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|