C25H28Cl2N2O — CID 3672650
3,4-dichloro-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-pentylbenzamide (PubChem CID 3672650) has the molecular formula C25H28Cl2N2O and a molecular weight of 443.42 g/mol. Its IUPAC name is 3,4-dichloro-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-pentylbenzamide.
| Compound Name | 3,4-dichloro-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-pentylbenzamide |
|---|---|
| PubChem CID | 3672650 |
| Molecular Formula | C25H28Cl2N2O |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 3,4-dichloro-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-pentylbenzamide |
| SMILES | CCCCCN(Cc1cccn1Cc1cccc(C)c1)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H28Cl2N2O/c1-3-4-5-13-29(25(30)21-11-12-23(26)24(27)16-21)18-22-10-7-14-28(22)17-20-9-6-8-19(2)15-20/h6-12,14-16H,3-5,13,17-18H2,1-2H3 |
| InChIKey | QFLJWYDBLCVNIB-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|