C26H32N2O2 — CID 5030621
N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-4-methyl-N-pentylbenzamide (PubChem CID 5030621) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-4-methyl-N-pentylbenzamide.
| Compound Name | N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-4-methyl-N-pentylbenzamide |
|---|---|
| PubChem CID | 5030621 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-4-methyl-N-pentylbenzamide |
| SMILES | CCCCCN(Cc1cccn1Cc1cccc(OC)c1)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H32N2O2/c1-4-5-6-16-28(26(29)23-14-12-21(2)13-15-23)20-24-10-8-17-27(24)19-22-9-7-11-25(18-22)30-3/h7-15,17-18H,4-6,16,19-20H2,1-3H3 |
| InChIKey | WBQFKEKSSXQQEG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|