C25H30N2O2 — CID 5219910
N-butyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-2-phenylacetamide (PubChem CID 5219910) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-butyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-2-phenylacetamide.
| Compound Name | N-butyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 5219910 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N-butyl-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-2-phenylacetamide |
| SMILES | CCCCN(Cc1cccn1Cc1cccc(OC)c1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C25H30N2O2/c1-3-4-15-27(25(28)18-21-10-6-5-7-11-21)20-23-13-9-16-26(23)19-22-12-8-14-24(17-22)29-2/h5-14,16-17H,3-4,15,18-20H2,1-2H3 |
| InChIKey | FSPNIHWFMLUNRG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |