C32H43N3O3 — CID 3688758
N-[2-[benzyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-N-butylhexanamide (PubChem CID 3688758) has the molecular formula C32H43N3O3 and a molecular weight of 517.71 g/mol. Its IUPAC name is N-[2-[benzyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-N-butylhexanamide.
| Compound Name | N-[2-[benzyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-N-butylhexanamide |
|---|---|
| PubChem CID | 3688758 |
| Molecular Formula | C32H43N3O3 |
| Molecular Weight | 517.71 g/mol |
| Exact Mass | 517.33 |
| IUPAC Name | N-[2-[benzyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-N-butylhexanamide |
| SMILES | CCCCCC(=O)N(CCCC)CC(=O)N(Cc1ccccc1)Cc1cccn1Cc1cccc(OC)c1 |
| InChI | InChI=1S/C32H43N3O3/c1-4-6-9-19-31(36)34(20-7-5-2)26-32(37)35(23-27-14-10-8-11-15-27)25-29-17-13-21-33(29)24-28-16-12-18-30(22-28)38-3/h8,10-18,21-22H,4-7,9,19-20,23-26H2,1-3H3 |
| InChIKey | JKGVOUMEKNKLQO-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.71 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|