C34H44F3N3O3 — CID 42767683
N-benzyl-N-[2-[3-methoxypropyl-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]octanamide (PubChem CID 42767683) has the molecular formula C34H44F3N3O3 and a molecular weight of 599.74 g/mol. Its IUPAC name is N-benzyl-N-[2-[3-methoxypropyl-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]octanamide.
| Compound Name | N-benzyl-N-[2-[3-methoxypropyl-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]octanamide |
|---|---|
| PubChem CID | 42767683 |
| Molecular Formula | C34H44F3N3O3 |
| Molecular Weight | 599.74 g/mol |
| Exact Mass | 599.33 |
| IUPAC Name | N-benzyl-N-[2-[3-methoxypropyl-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]octanamide |
| SMILES | CCCCCCCC(=O)N(CC(=O)N(CCCOC)Cc1cccn1Cc1cccc(C(F)(F)F)c1)Cc1ccccc1 |
| InChI | InChI=1S/C34H44F3N3O3/c1-3-4-5-6-10-19-32(41)40(24-28-14-8-7-9-15-28)27-33(42)39(21-13-22-43-2)26-31-18-12-20-38(31)25-29-16-11-17-30(23-29)34(35,36)37/h7-9,11-12,14-18,20,23H,3-6,10,13,19,21-22,24-27H2,1-2H3 |
| InChIKey | MWQMZGPHHOYMJS-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.74 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|