C27H38F3N3O2 — CID 3587109
N-ethyl-N-[2-oxo-2-[pentyl-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]amino]ethyl]pentanamide (PubChem CID 3587109) has the molecular formula C27H38F3N3O2 and a molecular weight of 493.61 g/mol. Its IUPAC name is N-ethyl-N-[2-oxo-2-[pentyl-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]amino]ethyl]pentanamide.
| Compound Name | N-ethyl-N-[2-oxo-2-[pentyl-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]amino]ethyl]pentanamide |
|---|---|
| PubChem CID | 3587109 |
| Molecular Formula | C27H38F3N3O2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | N-ethyl-N-[2-oxo-2-[pentyl-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]amino]ethyl]pentanamide |
| SMILES | CCCCCN(Cc1cccn1Cc1cccc(C(F)(F)F)c1)C(=O)CN(CC)C(=O)CCCC |
| InChI | InChI=1S/C27H38F3N3O2/c1-4-7-9-16-33(26(35)21-31(6-3)25(34)15-8-5-2)20-24-14-11-17-32(24)19-22-12-10-13-23(18-22)27(28,29)30/h10-14,17-18H,4-9,15-16,19-21H2,1-3H3 |
| InChIKey | IGMVEIXCZWGLFZ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|