C21H27F3N2O — CID 5032060
N-pentyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]propanamide (PubChem CID 5032060) has the molecular formula C21H27F3N2O and a molecular weight of 380.45 g/mol. Its IUPAC name is N-pentyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]propanamide.
| Compound Name | N-pentyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 5032060 |
| Molecular Formula | C21H27F3N2O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N-pentyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]propanamide |
| SMILES | CCCCCN(Cc1cccn1Cc1cccc(C(F)(F)F)c1)C(=O)CC |
| InChI | InChI=1S/C21H27F3N2O/c1-3-5-6-12-26(20(27)4-2)16-19-11-8-13-25(19)15-17-9-7-10-18(14-17)21(22,23)24/h7-11,13-14H,3-6,12,15-16H2,1-2H3 |
| InChIKey | LCONOWXLQSZRKK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|