C22H30F3N3O — CID 3888000
1-butyl-3-tert-butyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]urea (PubChem CID 3888000) has the molecular formula C22H30F3N3O and a molecular weight of 409.50 g/mol. Its IUPAC name is 1-butyl-3-tert-butyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]urea.
| Compound Name | 1-butyl-3-tert-butyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]urea |
|---|---|
| PubChem CID | 3888000 |
| Molecular Formula | C22H30F3N3O |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 1-butyl-3-tert-butyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]urea |
| SMILES | CCCCN(Cc1cccn1Cc1cccc(C(F)(F)F)c1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C22H30F3N3O/c1-5-6-12-28(20(29)26-21(2,3)4)16-19-11-8-13-27(19)15-17-9-7-10-18(14-17)22(23,24)25/h7-11,13-14H,5-6,12,15-16H2,1-4H3,(H,26,29) |
| InChIKey | SIGIBDLXIAQQEX-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |