C26H27F3N4O — CID 4299348
3-(4-cyanophenyl)-1-pentyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]urea (PubChem CID 4299348) has the molecular formula C26H27F3N4O and a molecular weight of 468.52 g/mol. Its IUPAC name is 3-(4-cyanophenyl)-1-pentyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]urea.
| Compound Name | 3-(4-cyanophenyl)-1-pentyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]urea |
|---|---|
| PubChem CID | 4299348 |
| Molecular Formula | C26H27F3N4O |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 3-(4-cyanophenyl)-1-pentyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]urea |
| SMILES | CCCCCN(Cc1cccn1Cc1cccc(C(F)(F)F)c1)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C26H27F3N4O/c1-2-3-4-14-33(25(34)31-23-12-10-20(17-30)11-13-23)19-24-9-6-15-32(24)18-21-7-5-8-22(16-21)26(27,28)29/h5-13,15-16H,2-4,14,18-19H2,1H3,(H,31,34) |
| InChIKey | BEERWIAGCOXTNU-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|