C24H33F3N2O — CID 4568943
N-pentyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]hexanamide (PubChem CID 4568943) has the molecular formula C24H33F3N2O and a molecular weight of 422.54 g/mol. Its IUPAC name is N-pentyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]hexanamide.
| Compound Name | N-pentyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]hexanamide |
|---|---|
| PubChem CID | 4568943 |
| Molecular Formula | C24H33F3N2O |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | N-pentyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]hexanamide |
| SMILES | CCCCCC(=O)N(CCCCC)Cc1cccn1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H33F3N2O/c1-3-5-7-14-23(30)29(15-8-6-4-2)19-22-13-10-16-28(22)18-20-11-9-12-21(17-20)24(25,26)27/h9-13,16-17H,3-8,14-15,18-19H2,1-2H3 |
| InChIKey | IKOOTLASERNAOJ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|