C21H29FN2O — CID 4243560
N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-propylhexanamide (PubChem CID 4243560) has the molecular formula C21H29FN2O and a molecular weight of 344.47 g/mol. Its IUPAC name is N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-propylhexanamide.
| Compound Name | N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-propylhexanamide |
|---|---|
| PubChem CID | 4243560 |
| Molecular Formula | C21H29FN2O |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-propylhexanamide |
| SMILES | CCCCCC(=O)N(CCC)Cc1cccn1Cc1cccc(F)c1 |
| InChI | InChI=1S/C21H29FN2O/c1-3-5-6-12-21(25)24(13-4-2)17-20-11-8-14-23(20)16-18-9-7-10-19(22)15-18/h7-11,14-15H,3-6,12-13,16-17H2,1-2H3 |
| InChIKey | GBULEIHNWARPRQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|